C24H32N2O5 — CID 135200868
4-[3,5-dimethoxy-4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]phenyl]morpholine (PubChem CID 135200868) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-[3,5-dimethoxy-4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]phenyl]morpholine.
| Compound Name | 4-[3,5-dimethoxy-4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 135200868 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 4-[3,5-dimethoxy-4-[(2-methoxy-4-morpholin-4-ylphenyl)methyl]phenyl]morpholine |
| SMILES | COc1cc(N2CCOCC2)ccc1Cc1c(OC)cc(N2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H32N2O5/c1-27-22-15-19(25-6-10-30-11-7-25)5-4-18(22)14-21-23(28-2)16-20(17-24(21)29-3)26-8-12-31-13-9-26/h4-5,15-17H,6-14H2,1-3H3 |
| InChIKey | DCPRYDLQZJHIMG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|