About bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride
bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride (PubChem CID 123629300) has the molecular formula C22H30ClN6O4-
and a molecular weight of 477.97 g/mol. Its IUPAC name is bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride.
Molecular Properties
| Compound Name | bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride |
| PubChem CID | 123629300 |
| Molecular Formula | C22H30ClN6O4- |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride |
| SMILES | [Cl-].[H]/N=N/c1ccc(N2CCOCC2)cc1OC.[H]/N=N/c1ccc(N2CCOCC2)cc1OC |
| InChI | InChI=1S/2C11H15N3O2.ClH/c2*1-15-11-8-9(2-3-10(11)13-12)14-4-6-16-7-5-14;/h2*2-3,8,12H,4-7H2,1H3;1H/p-1/b2*13-12+; |
| InChIKey | MFZQEKLIJGSVPM-ZVYVTKPGSA-M |
| XLogP | 1.39 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride?
The IUPAC name of bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride (CID 123629300) is bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride.
What is the SMILES notation for bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride?
The canonical SMILES for bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride is [Cl-].[H]/N=N/c1ccc(N2CCOCC2)cc1OC.[H]/N=N/c1ccc(N2CCOCC2)cc1OC.
What is the InChIKey of bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride?
The InChIKey is MFZQEKLIJGSVPM-ZVYVTKPGSA-M. The full InChI is InChI=1S/2C11H15N3O2.ClH/c2*1-15-11-8-9(2-3-10(11)13-12)14-4-6-16-7-5-14;/h2*2-3,8,12H,4-7H2,1H3;1H/p-1/b2*13-12+;.
What are the key properties of bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride?
bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride has a molecular weight of 477.97 g/mol, XLogP of 1.39, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2-methoxy-4-morpholin-4-ylphenyl)diazene);chloride is sourced from PubChem (CID 123629300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).