C15H23NO4 — CID 174708451
4-[4-(1,1-dimethoxyethyl)-3-methoxyphenyl]morpholine (PubChem CID 174708451) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-[4-(1,1-dimethoxyethyl)-3-methoxyphenyl]morpholine.
| Compound Name | 4-[4-(1,1-dimethoxyethyl)-3-methoxyphenyl]morpholine |
|---|---|
| PubChem CID | 174708451 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-[4-(1,1-dimethoxyethyl)-3-methoxyphenyl]morpholine |
| SMILES | COc1cc(N2CCOCC2)ccc1C(C)(OC)OC |
| InChI | InChI=1S/C15H23NO4/c1-15(18-3,19-4)13-6-5-12(11-14(13)17-2)16-7-9-20-10-8-16/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | APXBVDPMKMOEBH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|