C17H18FNO2 — CID 131890518
4-[4-(5-fluoro-2-methoxyphenyl)phenyl]morpholine (PubChem CID 131890518) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]morpholine.
| Compound Name | 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]morpholine |
|---|---|
| PubChem CID | 131890518 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]morpholine |
| SMILES | COc1ccc(F)cc1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H18FNO2/c1-20-17-7-4-14(18)12-16(17)13-2-5-15(6-3-13)19-8-10-21-11-9-19/h2-7,12H,8-11H2,1H3 |
| InChIKey | KZTAPYJPEOAJQM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |