C25H28FN3O — CID 71478842
4-[5-fluoro-2-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-N,N-dimethylaniline (PubChem CID 71478842) has the molecular formula C25H28FN3O and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-[5-fluoro-2-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-N,N-dimethylaniline.
| Compound Name | 4-[5-fluoro-2-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 71478842 |
| Molecular Formula | C25H28FN3O |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 4-[5-fluoro-2-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(N2CCN(c3ccc(F)cc3-c3ccc(N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H28FN3O/c1-27(2)21-7-4-19(5-8-21)24-18-20(26)6-13-25(24)29-16-14-28(15-17-29)22-9-11-23(30-3)12-10-22/h4-13,18H,14-17H2,1-3H3 |
| InChIKey | UFHWLKCQLLDZAV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|