C29H31FN2O2 — CID 171637428
1-[4-[3-(4-fluorophenyl)-7-methoxy-2H-chromen-4-yl]phenyl]-4-propan-2-ylpiperazine (PubChem CID 171637428) has the molecular formula C29H31FN2O2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 1-[4-[3-(4-fluorophenyl)-7-methoxy-2H-chromen-4-yl]phenyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[4-[3-(4-fluorophenyl)-7-methoxy-2H-chromen-4-yl]phenyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 171637428 |
| Molecular Formula | C29H31FN2O2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-[4-[3-(4-fluorophenyl)-7-methoxy-2H-chromen-4-yl]phenyl]-4-propan-2-ylpiperazine |
| SMILES | COc1ccc2c(c1)OCC(c1ccc(F)cc1)=C2c1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H31FN2O2/c1-20(2)31-14-16-32(17-15-31)24-10-6-22(7-11-24)29-26-13-12-25(33-3)18-28(26)34-19-27(29)21-4-8-23(30)9-5-21/h4-13,18,20H,14-17,19H2,1-3H3 |
| InChIKey | QHBIBRLXHLGLDK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|