C32H36N3O2+ — CID 174284846
3-[4-[4-(8-methoxy-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)phenyl]piperazin-1-yl]butyl-methylidyneazanium (PubChem CID 174284846) has the molecular formula C32H36N3O2+ and a molecular weight of 494.66 g/mol. Its IUPAC name is 3-[4-[4-(8-methoxy-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)phenyl]piperazin-1-yl]butyl-methylidyneazanium.
| Compound Name | 3-[4-[4-(8-methoxy-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)phenyl]piperazin-1-yl]butyl-methylidyneazanium |
|---|---|
| PubChem CID | 174284846 |
| Molecular Formula | C32H36N3O2+ |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 3-[4-[4-(8-methoxy-4-phenyl-2,3-dihydro-1-benzoxepin-5-yl)phenyl]piperazin-1-yl]butyl-methylidyneazanium |
| SMILES | C#[N+]CCC(C)N1CCN(c2ccc(C3=C(c4ccccc4)CCOc4cc(OC)ccc43)cc2)CC1 |
| InChI | InChI=1S/C32H36N3O2/c1-24(15-17-33-2)34-18-20-35(21-19-34)27-11-9-26(10-12-27)32-29(25-7-5-4-6-8-25)16-22-37-31-23-28(36-3)13-14-30(31)32/h2,4-14,23-24H,15-22H2,1,3H3/q+1 |
| InChIKey | ZTJUGHUSXFJPRX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 29.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|