C33H39NO3 — CID 174284843
4-[8-methoxy-5-[4-(4-propan-2-ylazocan-1-yl)phenyl]-2,3-dihydro-1-benzoxepin-4-yl]phenol (PubChem CID 174284843) has the molecular formula C33H39NO3 and a molecular weight of 497.68 g/mol. Its IUPAC name is 4-[8-methoxy-5-[4-(4-propan-2-ylazocan-1-yl)phenyl]-2,3-dihydro-1-benzoxepin-4-yl]phenol.
| Compound Name | 4-[8-methoxy-5-[4-(4-propan-2-ylazocan-1-yl)phenyl]-2,3-dihydro-1-benzoxepin-4-yl]phenol |
|---|---|
| PubChem CID | 174284843 |
| Molecular Formula | C33H39NO3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 4-[8-methoxy-5-[4-(4-propan-2-ylazocan-1-yl)phenyl]-2,3-dihydro-1-benzoxepin-4-yl]phenol |
| SMILES | COc1ccc2c(c1)OCCC(c1ccc(O)cc1)=C2c1ccc(N2CCCCC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C33H39NO3/c1-23(2)24-6-4-5-19-34(20-17-24)27-11-7-26(8-12-27)33-30(25-9-13-28(35)14-10-25)18-21-37-32-22-29(36-3)15-16-31(32)33/h7-16,22-24,35H,4-6,17-21H2,1-3H3 |
| InChIKey | XFIAHGCCAQAFLP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|