C28H35NO5 — CID 170564476
4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]piperidine (PubChem CID 170564476) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 170564476 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]piperidine |
| SMILES | COC(OC)C1CCN(c2ccc(C3=CCOc4cc(OC5CCCCO5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C28H35NO5/c1-30-28(31-2)21-12-15-29(16-13-21)22-8-6-20(7-9-22)24-14-18-32-26-19-23(10-11-25(24)26)34-27-5-3-4-17-33-27/h6-11,14,19,21,27-28H,3-5,12-13,15-18H2,1-2H3 |
| InChIKey | OIENXAKMQDLXEU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|