C32H39BrN2O5 — CID 175973134
tert-butyl 2-[4-[3-bromo-7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 175973134) has the molecular formula C32H39BrN2O5 and a molecular weight of 611.58 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-bromo-7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[4-[3-bromo-7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 175973134 |
| Molecular Formula | C32H39BrN2O5 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | tert-butyl 2-[4-[3-bromo-7-(oxan-2-yloxy)-2H-chromen-4-yl]phenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(c1ccc(C3=C(Br)COc4cc(OC5CCCCO5)ccc43)cc1)C2 |
| InChI | InChI=1S/C32H39BrN2O5/c1-31(2,3)40-30(36)34-15-13-32(14-16-34)20-35(21-32)23-9-7-22(8-10-23)29-25-12-11-24(18-27(25)38-19-26(29)33)39-28-6-4-5-17-37-28/h7-12,18,28H,4-6,13-17,19-21H2,1-3H3 |
| InChIKey | UYKMJGXVQWQHCB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|