C21H30N4O4 — CID 166142994
tert-butyl 4-[2-(4-nitrophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidine-1-carboxylate (PubChem CID 166142994) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-nitrophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-nitrophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166142994 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | tert-butyl 4-[2-(4-nitrophenyl)-2,6-diazaspiro[3.3]heptan-6-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CC3(CN(c4ccc([N+](=O)[O-])cc4)C3)C2)CC1 |
| InChI | InChI=1S/C21H30N4O4/c1-20(2,3)29-19(26)22-10-8-17(9-11-22)24-14-21(15-24)12-23(13-21)16-4-6-18(7-5-16)25(27)28/h4-7,17H,8-15H2,1-3H3 |
| InChIKey | PONCOUFLBWNLRP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|