About ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane
ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane (PubChem CID 166143272) has the molecular formula C18H28N4O2
and a molecular weight of 332.45 g/mol. Its IUPAC name is ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 166143272 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane |
| SMILES | CC.O=[N+]([O-])c1ccc(N2CC3(C2)CN(C2CCNCC2)C3)cc1 |
| InChI | InChI=1S/C16H22N4O2.C2H6/c21-20(22)15-3-1-13(2-4-15)18-9-16(10-18)11-19(12-16)14-5-7-17-8-6-14;1-2/h1-4,14,17H,5-12H2;1-2H3 |
| InChIKey | AJURCRTVFIZKHJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane?
The IUPAC name of ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane (CID 166143272) is ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane is CC.O=[N+]([O-])c1ccc(N2CC3(C2)CN(C2CCNCC2)C3)cc1.
What is the InChIKey of ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane?
The InChIKey is AJURCRTVFIZKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2.C2H6/c21-20(22)15-3-1-13(2-4-15)18-9-16(10-18)11-19(12-16)14-5-7-17-8-6-14;1-2/h1-4,14,17H,5-12H2;1-2H3.
What are the key properties of ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane?
ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane has a molecular weight of 332.45 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 166143272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).