C18H28N4O2 — CID 166143272
ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane (PubChem CID 166143272) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane.
| Compound Name | ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 166143272 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | ethane;2-(4-nitrophenyl)-6-piperidin-4-yl-2,6-diazaspiro[3.3]heptane |
| SMILES | CC.O=[N+]([O-])c1ccc(N2CC3(C2)CN(C2CCNCC2)C3)cc1 |
| InChI | InChI=1S/C16H22N4O2.C2H6/c21-20(22)15-3-1-13(2-4-15)18-9-16(10-18)11-19(12-16)14-5-7-17-8-6-14;1-2/h1-4,14,17H,5-12H2;1-2H3 |
| InChIKey | AJURCRTVFIZKHJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|