C13H18ClN3O2 — CID 177197386
7-(4-nitrophenyl)-2,7-diazaspiro[3.5]nonane;hydrochloride (PubChem CID 177197386) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 7-(4-nitrophenyl)-2,7-diazaspiro[3.5]nonane;hydrochloride.
| Compound Name | 7-(4-nitrophenyl)-2,7-diazaspiro[3.5]nonane;hydrochloride |
|---|---|
| PubChem CID | 177197386 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 7-(4-nitrophenyl)-2,7-diazaspiro[3.5]nonane;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(N2CCC3(CC2)CNC3)cc1 |
| InChI | InChI=1S/C13H17N3O2.ClH/c17-16(18)12-3-1-11(2-4-12)15-7-5-13(6-8-15)9-14-10-13;/h1-4,14H,5-10H2;1H |
| InChIKey | YEKZMPANLNAWBH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|