C13H20ClN3O2 — CID 69429847
1,1-dimethyl-4-(4-nitrophenyl)-1,4-diazepan-1-ium chloride (PubChem CID 69429847) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is 1,1-dimethyl-4-(4-nitrophenyl)-1,4-diazepan-1-ium chloride.
| Compound Name | 1,1-dimethyl-4-(4-nitrophenyl)-1,4-diazepan-1-ium chloride |
|---|---|
| PubChem CID | 69429847 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1,1-dimethyl-4-(4-nitrophenyl)-1,4-diazepan-1-ium chloride |
| SMILES | C[N+]1(C)CCCN(c2ccc([N+](=O)[O-])cc2)CC1.[Cl-] |
| InChI | InChI=1S/C13H20N3O2.ClH/c1-16(2)10-3-8-14(9-11-16)12-4-6-13(7-5-12)15(17)18;/h4-7H,3,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XWOGPZHWKVGJBV-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|