C16H19N5O2 — CID 133454249
1-(6-methylpyridazin-3-yl)-4-(4-nitrophenyl)-1,4-diazepane (PubChem CID 133454249) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(6-methylpyridazin-3-yl)-4-(4-nitrophenyl)-1,4-diazepane.
| Compound Name | 1-(6-methylpyridazin-3-yl)-4-(4-nitrophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 133454249 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(6-methylpyridazin-3-yl)-4-(4-nitrophenyl)-1,4-diazepane |
| SMILES | Cc1ccc(N2CCCN(c3ccc([N+](=O)[O-])cc3)CC2)nn1 |
| InChI | InChI=1S/C16H19N5O2/c1-13-3-8-16(18-17-13)20-10-2-9-19(11-12-20)14-4-6-15(7-5-14)21(22)23/h3-8H,2,9-12H2,1H3 |
| InChIKey | YETKOZOSXYRYKY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|