C18H21N5O3 — CID 121118614
N-(2-methyl-5-nitrophenyl)-1-(6-methylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 121118614) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-1-(6-methylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-1-(6-methylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121118614 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-1-(6-methylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(N2CCCC(C(=O)Nc3cc([N+](=O)[O-])ccc3C)C2)nn1 |
| InChI | InChI=1S/C18H21N5O3/c1-12-5-7-15(23(25)26)10-16(12)19-18(24)14-4-3-9-22(11-14)17-8-6-13(2)20-21-17/h5-8,10,14H,3-4,9,11H2,1-2H3,(H,19,24) |
| InChIKey | OSNNFKCYYSEHPG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|