C20H21N7O3 — CID 90514403
N-(2-methyl-4-nitrophenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 90514403) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-methyl-4-nitrophenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90514403 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C1CCCN(c2ccc(-n3cccn3)nn2)C1 |
| InChI | InChI=1S/C20H21N7O3/c1-14-12-16(27(29)30)5-6-17(14)22-20(28)15-4-2-10-25(13-15)18-7-8-19(24-23-18)26-11-3-9-21-26/h3,5-9,11-12,15H,2,4,10,13H2,1H3,(H,22,28) |
| InChIKey | AWWDRYRJYPKLLW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|