C23H22FN5O4 — CID 121071300
1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-3-carboxamide (PubChem CID 121071300) has the molecular formula C23H22FN5O4 and a molecular weight of 451.46 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-3-carboxamide.
| Compound Name | 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071300 |
| Molecular Formula | C23H22FN5O4 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-methoxy-4-nitrophenyl)piperidine-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C1CCCN(c2ccc(-c3ccc(F)cc3)nn2)C1 |
| InChI | InChI=1S/C23H22FN5O4/c1-33-21-13-18(29(31)32)8-9-20(21)25-23(30)16-3-2-12-28(14-16)22-11-10-19(26-27-22)15-4-6-17(24)7-5-15/h4-11,13,16H,2-3,12,14H2,1H3,(H,25,30) |
| InChIKey | NHSFQRWWZVNAAO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|