C22H19N7O3 — CID 121071084
N-(2-cyano-4-nitrophenyl)-1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 121071084) has the molecular formula C22H19N7O3 and a molecular weight of 429.44 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071084 |
| Molecular Formula | C22H19N7O3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-1-(6-pyridin-3-ylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)C1CCCN(c2ccc(-c3cccnc3)nn2)C1 |
| InChI | InChI=1S/C22H19N7O3/c23-12-17-11-18(29(31)32)5-6-19(17)25-22(30)16-4-2-10-28(14-16)21-8-7-20(26-27-21)15-3-1-9-24-13-15/h1,3,5-9,11,13,16H,2,4,10,14H2,(H,25,30) |
| InChIKey | XBXYLOZDNOGMPY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|