C23H20FN5O — CID 121071274
N-(2-cyanophenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 121071274) has the molecular formula C23H20FN5O and a molecular weight of 401.45 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071274 |
| Molecular Formula | C23H20FN5O |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-(2-cyanophenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CCCN(c2ccc(-c3ccc(F)cc3)nn2)C1 |
| InChI | InChI=1S/C23H20FN5O/c24-19-9-7-16(8-10-19)21-11-12-22(28-27-21)29-13-3-5-18(15-29)23(30)26-20-6-2-1-4-17(20)14-25/h1-2,4,6-12,18H,3,5,13,15H2,(H,26,30) |
| InChIKey | JSTQVVCDKXTLPB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |