C23H30FN5O — CID 53004866
1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide (PubChem CID 53004866) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53004866 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-(2-piperidin-1-ylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCN1CCCCC1)C1CCCN(c2ccc(-c3ccc(F)cc3)nn2)C1 |
| InChI | InChI=1S/C23H30FN5O/c24-20-8-6-18(7-9-20)21-10-11-22(27-26-21)29-15-4-5-19(17-29)23(30)25-12-16-28-13-2-1-3-14-28/h6-11,19H,1-5,12-17H2,(H,25,30) |
| InChIKey | VVHKODJRLZGJBG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |