C26H25FN6O2S — CID 121071330
1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-3-carboxamide (PubChem CID 121071330) has the molecular formula C26H25FN6O2S and a molecular weight of 504.59 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-3-carboxamide.
| Compound Name | 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071330 |
| Molecular Formula | C26H25FN6O2S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 1-[6-(4-fluorophenyl)pyridazin-3-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(-c2cccs2)nn1)C1CCCN(c2ccc(-c3ccc(F)cc3)nn2)C1 |
| InChI | InChI=1S/C26H25FN6O2S/c27-20-7-5-18(6-8-20)21-9-11-24(31-29-21)33-14-1-3-19(17-33)26(34)28-13-15-35-25-12-10-22(30-32-25)23-4-2-16-36-23/h2,4-12,16,19H,1,3,13-15,17H2,(H,28,34) |
| InChIKey | XXLQZFZUBDGVIR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|