C26H26N6O2S — CID 121072092
1-(6-phenylpyridazin-3-yl)-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-4-carboxamide (PubChem CID 121072092) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 1-(6-phenylpyridazin-3-yl)-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-4-carboxamide.
| Compound Name | 1-(6-phenylpyridazin-3-yl)-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121072092 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-(6-phenylpyridazin-3-yl)-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(-c2cccs2)nn1)C1CCN(c2ccc(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C26H26N6O2S/c33-26(27-14-17-34-25-11-9-22(29-31-25)23-7-4-18-35-23)20-12-15-32(16-13-20)24-10-8-21(28-30-24)19-5-2-1-3-6-19/h1-11,18,20H,12-17H2,(H,27,33) |
| InChIKey | CTUSAVPQAPGPKW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|