C22H24N4OS — CID 20947338
N-[(3-methylphenyl)methyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 20947338) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-[(3-methylphenyl)methyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20947338 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(CNC(=O)C2CCN(c3ccc(-c4cccs4)nn3)CC2)c1 |
| InChI | InChI=1S/C22H24N4OS/c1-16-4-2-5-17(14-16)15-23-22(27)18-9-11-26(12-10-18)21-8-7-19(24-25-21)20-6-3-13-28-20/h2-8,13-14,18H,9-12,15H2,1H3,(H,23,27) |
| InChIKey | OQICJCAZWMWBMF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |