C20H21N5OS — CID 20947252
N-(4-methyl-2-pyridinyl)-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 20947252) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20947252 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(c3ccc(-c4cccs4)nn3)CC2)c1 |
| InChI | InChI=1S/C20H21N5OS/c1-14-6-9-21-18(13-14)22-20(26)15-7-10-25(11-8-15)19-5-4-16(23-24-19)17-3-2-12-27-17/h2-6,9,12-13,15H,7-8,10-11H2,1H3,(H,21,22,26) |
| InChIKey | USPZFPQTCLRMMI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |