C23H23F3N4O2S — CID 121071369
1-(6-thiophen-2-ylpyridazin-3-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-3-carboxamide (PubChem CID 121071369) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is 1-(6-thiophen-2-ylpyridazin-3-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(6-thiophen-2-ylpyridazin-3-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071369 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-(6-thiophen-2-ylpyridazin-3-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCOc1cccc(C(F)(F)F)c1)C1CCCN(c2ccc(-c3cccs3)nn2)C1 |
| InChI | InChI=1S/C23H23F3N4O2S/c24-23(25,26)17-5-1-6-18(14-17)32-12-10-27-22(31)16-4-2-11-30(15-16)21-9-8-19(28-29-21)20-7-3-13-33-20/h1,3,5-9,13-14,16H,2,4,10-12,15H2,(H,27,31) |
| InChIKey | HBPGVJZNRVFACH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|