C26H30N6O3S — CID 121071421
N-[2-[[4-(propanoylamino)benzoyl]amino]ethyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 121071421) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[2-[[4-(propanoylamino)benzoyl]amino]ethyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-[2-[[4-(propanoylamino)benzoyl]amino]ethyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071421 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-[2-[[4-(propanoylamino)benzoyl]amino]ethyl]-1-(6-thiophen-2-ylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NCCNC(=O)C2CCCN(c3ccc(-c4cccs4)nn3)C2)cc1 |
| InChI | InChI=1S/C26H30N6O3S/c1-2-24(33)29-20-9-7-18(8-10-20)25(34)27-13-14-28-26(35)19-5-3-15-32(17-19)23-12-11-21(30-31-23)22-6-4-16-36-22/h4,6-12,16,19H,2-3,5,13-15,17H2,1H3,(H,27,34)(H,28,35)(H,29,33) |
| InChIKey | INZHWUMXMFEUJW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|