C22H30N4O — CID 53056953
N-butyl-1-[6-(3,4-dimethylphenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 53056953) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N-butyl-1-[6-(3,4-dimethylphenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-butyl-1-[6-(3,4-dimethylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53056953 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-butyl-1-[6-(3,4-dimethylphenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(c2ccc(-c3ccc(C)c(C)c3)nn2)C1 |
| InChI | InChI=1S/C22H30N4O/c1-4-5-12-23-22(27)19-7-6-13-26(15-19)21-11-10-20(24-25-21)18-9-8-16(2)17(3)14-18/h8-11,14,19H,4-7,12-13,15H2,1-3H3,(H,23,27) |
| InChIKey | ZPTUANXGWSHUJT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|