C24H33N5O2 — CID 93055910
(3S)-1-[6-(3-methylphenyl)pyridazin-3-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide (PubChem CID 93055910) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3S)-1-[6-(3-methylphenyl)pyridazin-3-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[6-(3-methylphenyl)pyridazin-3-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93055910 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (3S)-1-[6-(3-methylphenyl)pyridazin-3-yl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(-c2ccc(N3CCC[C@H](C(=O)NCCCN4CCOCC4)C3)nn2)c1 |
| InChI | InChI=1S/C24H33N5O2/c1-19-5-2-6-20(17-19)22-8-9-23(27-26-22)29-12-3-7-21(18-29)24(30)25-10-4-11-28-13-15-31-16-14-28/h2,5-6,8-9,17,21H,3-4,7,10-16,18H2,1H3,(H,25,30)/t21-/m0/s1 |
| InChIKey | HMKUBZPVXCCEPK-NRFANRHFSA-N |
| XLogP | 2.51 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|