C26H22N8O3 — CID 121104094
N-(2-cyano-4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 121104094) has the molecular formula C26H22N8O3 and a molecular weight of 494.52 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121104094 |
| Molecular Formula | C26H22N8O3 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)C1CCCN(c2ccc(-n3ccnc3-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C26H22N8O3/c27-16-20-15-21(34(36)37)8-9-22(20)29-26(35)19-7-4-13-32(17-19)23-10-11-24(31-30-23)33-14-12-28-25(33)18-5-2-1-3-6-18/h1-3,5-6,8-12,14-15,19H,4,7,13,17H2,(H,29,35) |
| InChIKey | LDKWCEYJEAIFBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 142.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|