C25H23N7O3 — CID 121103992
N-(4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 121103992) has the molecular formula C25H23N7O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-(4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121103992 |
| Molecular Formula | C25H23N7O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-(4-nitrophenyl)-1-[6-(2-phenylimidazol-1-yl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C1CCCN(c2ccc(-n3ccnc3-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C25H23N7O3/c33-25(27-20-8-10-21(11-9-20)32(34)35)19-7-4-15-30(17-19)22-12-13-23(29-28-22)31-16-14-26-24(31)18-5-2-1-3-6-18/h1-3,5-6,8-14,16,19H,4,7,15,17H2,(H,27,33) |
| InChIKey | DETPCBVZFSEZKJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|