C15H19N5O4S — CID 133282675
1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(4-nitrophenyl)piperazine (PubChem CID 133282675) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 133282675 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-(1,2-dimethylimidazol-4-yl)sulfonyl-4-(4-nitrophenyl)piperazine |
| SMILES | Cc1nc(S(=O)(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cn1C |
| InChI | InChI=1S/C15H19N5O4S/c1-12-16-15(11-17(12)2)25(23,24)19-9-7-18(8-10-19)13-3-5-14(6-4-13)20(21)22/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | QXCFPDCTLBUKAH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|