C14H13Br2N3O4S2 — CID 4108166
1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(4-nitrophenyl)piperazine (PubChem CID 4108166) has the molecular formula C14H13Br2N3O4S2 and a molecular weight of 511.22 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 4108166 |
| Molecular Formula | C14H13Br2N3O4S2 |
| Molecular Weight | 511.22 g/mol |
| Exact Mass | 508.87 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(4-nitrophenyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)c3cc(Br)c(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C14H13Br2N3O4S2/c15-12-9-13(24-14(12)16)25(22,23)18-7-5-17(6-8-18)10-1-3-11(4-2-10)19(20)21/h1-4,9H,5-8H2 |
| InChIKey | JSBNOYRKPFQJCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|