C16H18Br2N2O2S2 — CID 5003165
1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(2,5-dimethylphenyl)piperazine (PubChem CID 5003165) has the molecular formula C16H18Br2N2O2S2 and a molecular weight of 494.27 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(2,5-dimethylphenyl)piperazine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(2,5-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 5003165 |
| Molecular Formula | C16H18Br2N2O2S2 |
| Molecular Weight | 494.27 g/mol |
| Exact Mass | 491.92 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-(2,5-dimethylphenyl)piperazine |
| SMILES | Cc1ccc(C)c(N2CCN(S(=O)(=O)c3cc(Br)c(Br)s3)CC2)c1 |
| InChI | InChI=1S/C16H18Br2N2O2S2/c1-11-3-4-12(2)14(9-11)19-5-7-20(8-6-19)24(21,22)15-10-13(17)16(18)23-15/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | JWXMNAXWMSFMTD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |