C14H13Br2ClN2O2S2 — CID 3587621
1-(2-chlorophenyl)-4-(4,5-dibromothiophen-2-yl)sulfonylpiperazine (PubChem CID 3587621) has the molecular formula C14H13Br2ClN2O2S2 and a molecular weight of 500.67 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-(4,5-dibromothiophen-2-yl)sulfonylpiperazine.
| Compound Name | 1-(2-chlorophenyl)-4-(4,5-dibromothiophen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 3587621 |
| Molecular Formula | C14H13Br2ClN2O2S2 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 497.85 |
| IUPAC Name | 1-(2-chlorophenyl)-4-(4,5-dibromothiophen-2-yl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1cc(Br)c(Br)s1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H13Br2ClN2O2S2/c15-10-9-13(22-14(10)16)23(20,21)19-7-5-18(6-8-19)12-4-2-1-3-11(12)17/h1-4,9H,5-8H2 |
| InChIKey | GOLFFIXUDYKDDV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |