C11H17Br2N2O2S2+ — CID 4076965
1-(4,5-dibromothiophen-2-yl)sulfonyl-4-propylpiperazin-4-ium (PubChem CID 4076965) has the molecular formula C11H17Br2N2O2S2+ and a molecular weight of 433.21 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-propylpiperazin-4-ium.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-propylpiperazin-4-ium |
|---|---|
| PubChem CID | 4076965 |
| Molecular Formula | C11H17Br2N2O2S2+ |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 430.91 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)sulfonyl-4-propylpiperazin-4-ium |
| SMILES | CCC[NH+]1CCN(S(=O)(=O)c2cc(Br)c(Br)s2)CC1 |
| InChI | InChI=1S/C11H16Br2N2O2S2/c1-2-3-14-4-6-15(7-5-14)19(16,17)10-8-9(12)11(13)18-10/h8H,2-7H2,1H3/p+1 |
| InChIKey | ZEMJXTLRZIMGJM-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |