C11H16BrN3O2S3 — CID 79988846
2-[4-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanethioamide (PubChem CID 79988846) has the molecular formula C11H16BrN3O2S3 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-[4-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 79988846 |
| Molecular Formula | C11H16BrN3O2S3 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 2-[4-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanethioamide |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(CC(N)=S)CC2)sc1Br |
| InChI | InChI=1S/C11H16BrN3O2S3/c1-8-6-10(19-11(8)12)20(16,17)15-4-2-14(3-5-15)7-9(13)18/h6H,2-5,7H2,1H3,(H2,13,18) |
| InChIKey | QAEOFIBMPAYCRV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|