C19H20N4O6S — CID 76694298
N-hydroxy-3-[4-[4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide (PubChem CID 76694298) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is N-hydroxy-3-[4-[4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[4-[4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76694298 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-hydroxy-3-[4-[4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1)NO |
| InChI | InChI=1S/C19H20N4O6S/c24-19(20-25)10-3-15-1-8-18(9-2-15)30(28,29)22-13-11-21(12-14-22)16-4-6-17(7-5-16)23(26)27/h1-10,25H,11-14H2,(H,20,24) |
| InChIKey | NTZRDZQLNFIOGK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|