C26H33N5O5S — CID 24979598
(E)-N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 24979598) has the molecular formula C26H33N5O5S and a molecular weight of 527.65 g/mol. Its IUPAC name is (E)-N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24979598 |
| Molecular Formula | C26H33N5O5S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (E)-N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H33N5O5S/c1-2-28-16-18-29(19-17-28)25-12-11-23(37(35,36)30-14-4-3-5-15-30)20-24(25)27-26(32)13-8-21-6-9-22(10-7-21)31(33)34/h6-13,20H,2-5,14-19H2,1H3,(H,27,32)/b13-8+ |
| InChIKey | ITUWNGFOUGBZAY-MDWZMJQESA-N |
| XLogP | 3.56 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|