C27H38N4O3S — CID 24979456
N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide (PubChem CID 24979456) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 24979456 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2NC(=O)CC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H38N4O3S/c1-3-29-16-18-30(19-17-29)26-13-12-24(35(33,34)31-14-8-5-9-15-31)21-25(26)28-27(32)20-22(2)23-10-6-4-7-11-23/h4,6-7,10-13,21-22H,3,5,8-9,14-20H2,1-2H3,(H,28,32) |
| InChIKey | JXBLPJGBROKOIX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |