C26H36N4O3S — CID 25466236
(3S)-N-[2-(4-methylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide (PubChem CID 25466236) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is (3S)-N-[2-(4-methylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide.
| Compound Name | (3S)-N-[2-(4-methylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 25466236 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (3S)-N-[2-(4-methylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-3-phenylbutanamide |
| SMILES | C[C@@H](CC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCN(C)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H36N4O3S/c1-21(22-9-5-3-6-10-22)19-26(31)27-24-20-23(34(32,33)30-13-7-4-8-14-30)11-12-25(24)29-17-15-28(2)16-18-29/h3,5-6,9-12,20-21H,4,7-8,13-19H2,1-2H3,(H,27,31)/t21-/m0/s1 |
| InChIKey | PYGUYWZTXBWZKW-NRFANRHFSA-N |
| XLogP | 3.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |