C22H28N4O3S — CID 16557461
N-[2-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 16557461) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 16557461 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H28N4O3S/c1-24-14-16-25(17-15-24)21-7-3-2-6-20(21)23-22(27)18-8-10-19(11-9-18)30(28,29)26-12-4-5-13-26/h2-3,6-11H,4-5,12-17H2,1H3,(H,23,27) |
| InChIKey | LLAUYOSBDBMBFD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |