C23H31N5O3S — CID 55359411
N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 55359411) has the molecular formula C23H31N5O3S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55359411 |
| Molecular Formula | C23H31N5O3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)c2cccc(S(=O)(=O)N3CCN(C)CC3)c2)CC1 |
| InChI | InChI=1S/C23H31N5O3S/c1-25-10-14-27(15-11-25)22-9-4-3-8-21(22)24-23(29)19-6-5-7-20(18-19)32(30,31)28-16-12-26(2)13-17-28/h3-9,18H,10-17H2,1-2H3,(H,24,29) |
| InChIKey | SMAYYWYAXXQTDB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |