C24H31N5O4S — CID 43024824
3-(4-acetylpiperazin-1-yl)sulfonyl-N-[2-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 43024824) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[2-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[2-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 43024824 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-N-[2-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)Nc3ccccc3N3CCN(C)CC3)c2)CC1 |
| InChI | InChI=1S/C24H31N5O4S/c1-19(30)27-14-16-29(17-15-27)34(32,33)21-7-5-6-20(18-21)24(31)25-22-8-3-4-9-23(22)28-12-10-26(2)11-13-28/h3-9,18H,10-17H2,1-2H3,(H,25,31) |
| InChIKey | PNHVRDFDXGSWOF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |