C20H23N3O4S — CID 57327123
N-[2-(4-acetylpiperazin-1-yl)phenyl]-3-methylsulfonylbenzamide (PubChem CID 57327123) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[2-(4-acetylpiperazin-1-yl)phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[2-(4-acetylpiperazin-1-yl)phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 57327123 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[2-(4-acetylpiperazin-1-yl)phenyl]-3-methylsulfonylbenzamide |
| SMILES | CC(=O)N1CCN(c2ccccc2NC(=O)c2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C20H23N3O4S/c1-15(24)22-10-12-23(13-11-22)19-9-4-3-8-18(19)21-20(25)16-6-5-7-17(14-16)28(2,26)27/h3-9,14H,10-13H2,1-2H3,(H,21,25) |
| InChIKey | DBYCJSBGNJLJBR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |