C25H33FN4O3S — CID 25332698
N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-(3-fluorophenyl)acetamide (PubChem CID 25332698) has the molecular formula C25H33FN4O3S and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 25332698 |
| Molecular Formula | C25H33FN4O3S |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2NC(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H33FN4O3S/c1-2-28-13-15-29(16-14-28)24-10-9-22(34(32,33)30-11-4-3-5-12-30)19-23(24)27-25(31)18-20-7-6-8-21(26)17-20/h6-10,17,19H,2-5,11-16,18H2,1H3,(H,27,31) |
| InChIKey | VGTGQCPFZPXUFZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |