C25H34N4O4S — CID 24980516
N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-phenoxyacetamide (PubChem CID 24980516) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-phenoxyacetamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 24980516 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]-2-phenoxyacetamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2NC(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N4O4S/c1-2-27-15-17-28(18-16-27)24-12-11-22(34(31,32)29-13-7-4-8-14-29)19-23(24)26-25(30)20-33-21-9-5-3-6-10-21/h3,5-6,9-12,19H,2,4,7-8,13-18,20H2,1H3,(H,26,30) |
| InChIKey | AODGLSATRZIHRS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |