C24H38N4O3S — CID 17422008
N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]cyclohexanecarboxamide (PubChem CID 17422008) has the molecular formula C24H38N4O3S and a molecular weight of 462.66 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17422008 |
| Molecular Formula | C24H38N4O3S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-5-piperidin-1-ylsulfonylphenyl]cyclohexanecarboxamide |
| SMILES | CCN1CCN(c2ccc(S(=O)(=O)N3CCCCC3)cc2NC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H38N4O3S/c1-2-26-15-17-27(18-16-26)23-12-11-21(32(30,31)28-13-7-4-8-14-28)19-22(23)25-24(29)20-9-5-3-6-10-20/h11-12,19-20H,2-10,13-18H2,1H3,(H,25,29) |
| InChIKey | FOJSKLWJTFQZIZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |