C24H31ClN4O3S — CID 30862286
1-(benzenesulfonyl)-N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 30862286) has the molecular formula C24H31ClN4O3S and a molecular weight of 491.06 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30862286 |
| Molecular Formula | C24H31ClN4O3S |
| Molecular Weight | 491.06 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H31ClN4O3S/c1-2-27-14-16-28(17-15-27)23-9-8-20(25)18-22(23)26-24(30)19-10-12-29(13-11-19)33(31,32)21-6-4-3-5-7-21/h3-9,18-19H,2,10-17H2,1H3,(H,26,30) |
| InChIKey | DXYSBKQNCQEAGD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.06 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |