C25H33FN4O3S — CID 24525568
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 24525568) has the molecular formula C25H33FN4O3S and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24525568 |
| Molecular Formula | C25H33FN4O3S |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C3CCN(S(=O)(=O)c4ccc(F)cc4)CC3)cc2C)CC1 |
| InChI | InChI=1S/C25H33FN4O3S/c1-3-28-14-16-29(17-15-28)24-9-6-22(18-19(24)2)27-25(31)20-10-12-30(13-11-20)34(32,33)23-7-4-21(26)5-8-23/h4-9,18,20H,3,10-17H2,1-2H3,(H,27,31) |
| InChIKey | TUWZSWUZJSECPA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|